imranausaf77 imranausaf77

21-05-2021
English

contestada

Write a story in which an unexpected guest arrives at a wedding or a celebration

Respuesta :

juiceboxxkid juiceboxxkid

24-05-2021

Answer:

corona arriving while we're celebrating our lives

Explanation:

there's a topic you can write about, :)

Answer Link

Otras preguntas

Help me pls pls pls pls

How does art travel these days? What effects might this have on modern art?

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

Pore spaces are the spaces between the pieces in a rock or sediment. Water that fills these pore spaces is called groundwater. Imagine you pour water on sand. W

Suppose that f and g are functions that are differentiable at x = 1 and that f(1) = 2, f '(1) = −1, g(1) = −2, and g'(1) = 3. Find h'(1). h(x) = (x2 + 8)g(x)

Complete the sentences below with the correct indirect object pronouns.Nosotros queremos alquilar un apartamento. Vamos a ver un apartamento en la ciudad. El du

the area of the shape below I NEED HELP NOW

Students learn more if they drink tea before sitting for study . Your 20 students drink tea before study you test their learning by giving them questions

4.2 mol of oxygen and 4.0 mol of NO are introduced to an evacuated 0.50 L reaction vessel. At a specific temperature, the equilibrium 2NO(g) + O 2(g) 2NO 2(g) i

What is the measure of angle x? 10 20 30 40