jstation8 jstation8

24-10-2019
Geography

contestada

how many electronics are on the earth in 2019

Respuesta :

KenKenn82 KenKenn82

24-10-2019

Answer:

3.3 billion smartphone users in the world today.

35.13% of people have smartphones worldwide. 5.13 billion people have mobile devices in 2019.

66.53% of people have mobile devices worldwide.

Answer Link

Otras preguntas

Can someone help find the solutions

What was the African American point of view

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

Ceiling joists are usually placed so they’re ___ to the rafters? A. Parallel B. At 30 angles C. Perpendicular D. Diagonal

Help me in this question

Match the given term to its description: Systems Perspective

much help needed! tysm!! HELP.

How does Achebe create a "new English" with his use of language in "Civil Peace"? O He fills his English with Igbo language patterns and rhythm. O He creates a

How will the two daughters cells be? a) 100% identical b) Not identical

Work out the value of (3²)^2 x (10^3)^2